C7H6Br3NO2S — CID 107602651
1-bromo-N-(2,6-dibromophenyl)methanesulfonamide (PubChem CID 107602651) has the molecular formula C7H6Br3NO2S and a molecular weight of 407.91 g/mol. Its IUPAC name is 1-bromo-N-(2,6-dibromophenyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(2,6-dibromophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 107602651 |
| Molecular Formula | C7H6Br3NO2S |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 404.77 |
| IUPAC Name | 1-bromo-N-(2,6-dibromophenyl)methanesulfonamide |
| SMILES | O=S(=O)(CBr)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C7H6Br3NO2S/c8-4-14(12,13)11-7-5(9)2-1-3-6(7)10/h1-3,11H,4H2 |
| InChIKey | PJERQFMDWUNZBB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|