C10H12Br2ClNO2S — CID 107602655
4-chloro-N-(2,6-dibromophenyl)butane-1-sulfonamide (PubChem CID 107602655) has the molecular formula C10H12Br2ClNO2S and a molecular weight of 405.54 g/mol. Its IUPAC name is 4-chloro-N-(2,6-dibromophenyl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(2,6-dibromophenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 107602655 |
| Molecular Formula | C10H12Br2ClNO2S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 402.86 |
| IUPAC Name | 4-chloro-N-(2,6-dibromophenyl)butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCCCl)Nc1c(Br)cccc1Br |
| InChI | InChI=1S/C10H12Br2ClNO2S/c11-8-4-3-5-9(12)10(8)14-17(15,16)7-2-1-6-13/h3-5,14H,1-2,6-7H2 |
| InChIKey | CPPASMBIGIZKJO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|