C11H14Br2ClNO2S — CID 116814857
4-chloro-N-(2,6-dibromo-4-methylphenyl)butane-1-sulfonamide (PubChem CID 116814857) has the molecular formula C11H14Br2ClNO2S and a molecular weight of 419.57 g/mol. Its IUPAC name is 4-chloro-N-(2,6-dibromo-4-methylphenyl)butane-1-sulfonamide.
| Compound Name | 4-chloro-N-(2,6-dibromo-4-methylphenyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 116814857 |
| Molecular Formula | C11H14Br2ClNO2S |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 416.88 |
| IUPAC Name | 4-chloro-N-(2,6-dibromo-4-methylphenyl)butane-1-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)CCCCCl)c(Br)c1 |
| InChI | InChI=1S/C11H14Br2ClNO2S/c1-8-6-9(12)11(10(13)7-8)15-18(16,17)5-3-2-4-14/h6-7,15H,2-5H2,1H3 |
| InChIKey | INXHSMHSYXARIH-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|