C8H8BrCl2NO2S — CID 104727985
1-bromo-N-(2,5-dichloro-4-methylphenyl)methanesulfonamide (PubChem CID 104727985) has the molecular formula C8H8BrCl2NO2S and a molecular weight of 333.03 g/mol. Its IUPAC name is 1-bromo-N-(2,5-dichloro-4-methylphenyl)methanesulfonamide.
| Compound Name | 1-bromo-N-(2,5-dichloro-4-methylphenyl)methanesulfonamide |
|---|---|
| PubChem CID | 104727985 |
| Molecular Formula | C8H8BrCl2NO2S |
| Molecular Weight | 333.03 g/mol |
| Exact Mass | 330.88 |
| IUPAC Name | 1-bromo-N-(2,5-dichloro-4-methylphenyl)methanesulfonamide |
| SMILES | Cc1cc(Cl)c(NS(=O)(=O)CBr)cc1Cl |
| InChI | InChI=1S/C8H8BrCl2NO2S/c1-5-2-7(11)8(3-6(5)10)12-15(13,14)4-9/h2-3,12H,4H2,1H3 |
| InChIKey | VUMQXSAIYOOZLR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.03 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|