C9H9BrClNO4S — CID 104722416
2-[(2-bromo-5-chloro-4-methylphenyl)sulfamoyl]acetic acid (PubChem CID 104722416) has the molecular formula C9H9BrClNO4S and a molecular weight of 342.60 g/mol. Its IUPAC name is 2-[(2-bromo-5-chloro-4-methylphenyl)sulfamoyl]acetic acid.
| Compound Name | 2-[(2-bromo-5-chloro-4-methylphenyl)sulfamoyl]acetic acid |
|---|---|
| PubChem CID | 104722416 |
| Molecular Formula | C9H9BrClNO4S |
| Molecular Weight | 342.60 g/mol |
| Exact Mass | 340.91 |
| IUPAC Name | 2-[(2-bromo-5-chloro-4-methylphenyl)sulfamoyl]acetic acid |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)CC(=O)O)cc1Cl |
| InChI | InChI=1S/C9H9BrClNO4S/c1-5-2-6(10)8(3-7(5)11)12-17(15,16)4-9(13)14/h2-3,12H,4H2,1H3,(H,13,14) |
| InChIKey | VGPPLKPHIUPSDC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |