C11H14BrCl2NO2S — CID 104725034
N-(2-bromo-5-chloro-4-methylphenyl)-3-chloro-2-methylpropane-1-sulfonamide (PubChem CID 104725034) has the molecular formula C11H14BrCl2NO2S and a molecular weight of 375.12 g/mol. Its IUPAC name is N-(2-bromo-5-chloro-4-methylphenyl)-3-chloro-2-methylpropane-1-sulfonamide.
| Compound Name | N-(2-bromo-5-chloro-4-methylphenyl)-3-chloro-2-methylpropane-1-sulfonamide |
|---|---|
| PubChem CID | 104725034 |
| Molecular Formula | C11H14BrCl2NO2S |
| Molecular Weight | 375.12 g/mol |
| Exact Mass | 372.93 |
| IUPAC Name | N-(2-bromo-5-chloro-4-methylphenyl)-3-chloro-2-methylpropane-1-sulfonamide |
| SMILES | Cc1cc(Br)c(NS(=O)(=O)CC(C)CCl)cc1Cl |
| InChI | InChI=1S/C11H14BrCl2NO2S/c1-7(5-13)6-18(16,17)15-11-4-10(14)8(2)3-9(11)12/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | WUFUUUPAPDFRFJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.12 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|