C11H15BrClNO4S2 — CID 82756936
5-bromo-2-methyl-4-(2-methylpropylsulfonylamino)benzenesulfonyl chloride (PubChem CID 82756936) has the molecular formula C11H15BrClNO4S2 and a molecular weight of 404.74 g/mol. Its IUPAC name is 5-bromo-2-methyl-4-(2-methylpropylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 5-bromo-2-methyl-4-(2-methylpropylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82756936 |
| Molecular Formula | C11H15BrClNO4S2 |
| Molecular Weight | 404.74 g/mol |
| Exact Mass | 402.93 |
| IUPAC Name | 5-bromo-2-methyl-4-(2-methylpropylsulfonylamino)benzenesulfonyl chloride |
| SMILES | Cc1cc(NS(=O)(=O)CC(C)C)c(Br)cc1S(=O)(=O)Cl |
| InChI | InChI=1S/C11H15BrClNO4S2/c1-7(2)6-19(15,16)14-10-4-8(3)11(5-9(10)12)20(13,17)18/h4-5,7,14H,6H2,1-3H3 |
| InChIKey | IZYCPENJGBXEDR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.74 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |