C13H17BrClNO3S — CID 82757618
5-bromo-2-methyl-4-(2-methylpentanoylamino)benzenesulfonyl chloride (PubChem CID 82757618) has the molecular formula C13H17BrClNO3S and a molecular weight of 382.71 g/mol. Its IUPAC name is 5-bromo-2-methyl-4-(2-methylpentanoylamino)benzenesulfonyl chloride.
| Compound Name | 5-bromo-2-methyl-4-(2-methylpentanoylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82757618 |
| Molecular Formula | C13H17BrClNO3S |
| Molecular Weight | 382.71 g/mol |
| Exact Mass | 380.98 |
| IUPAC Name | 5-bromo-2-methyl-4-(2-methylpentanoylamino)benzenesulfonyl chloride |
| SMILES | CCCC(C)C(=O)Nc1cc(C)c(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C13H17BrClNO3S/c1-4-5-8(2)13(17)16-11-6-9(3)12(7-10(11)14)20(15,18)19/h6-8H,4-5H2,1-3H3,(H,16,17) |
| InChIKey | MUBWLZWPTHBIPP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |