C10H13BrClNO4S2 — CID 82757619
5-bromo-2-methyl-4-(propylsulfonylamino)benzenesulfonyl chloride (PubChem CID 82757619) has the molecular formula C10H13BrClNO4S2 and a molecular weight of 390.71 g/mol. Its IUPAC name is 5-bromo-2-methyl-4-(propylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 5-bromo-2-methyl-4-(propylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 82757619 |
| Molecular Formula | C10H13BrClNO4S2 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 388.92 |
| IUPAC Name | 5-bromo-2-methyl-4-(propylsulfonylamino)benzenesulfonyl chloride |
| SMILES | CCCS(=O)(=O)Nc1cc(C)c(S(=O)(=O)Cl)cc1Br |
| InChI | InChI=1S/C10H13BrClNO4S2/c1-3-4-18(14,15)13-9-5-7(2)10(6-8(9)11)19(12,16)17/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | LMIRWUWEEJCHOG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |