C13H18BrNO — CID 114309617
N-[2-(bromomethyl)phenyl]-2-methylpentanamide (PubChem CID 114309617) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is N-[2-(bromomethyl)phenyl]-2-methylpentanamide.
| Compound Name | N-[2-(bromomethyl)phenyl]-2-methylpentanamide |
|---|---|
| PubChem CID | 114309617 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | N-[2-(bromomethyl)phenyl]-2-methylpentanamide |
| SMILES | CCCC(C)C(=O)Nc1ccccc1CBr |
| InChI | InChI=1S/C13H18BrNO/c1-3-6-10(2)13(16)15-12-8-5-4-7-11(12)9-14/h4-5,7-8,10H,3,6,9H2,1-2H3,(H,15,16) |
| InChIKey | UFKSXAIBJMIURA-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|