C17H25NO3S — CID 40803024
(2S)-2-[2-[[(2R)-2-methylpentanoyl]amino]phenyl]sulfanylpentanoic acid (PubChem CID 40803024) has the molecular formula C17H25NO3S and a molecular weight of 323.46 g/mol. Its IUPAC name is (2S)-2-[2-[[(2R)-2-methylpentanoyl]amino]phenyl]sulfanylpentanoic acid.
| Compound Name | (2S)-2-[2-[[(2R)-2-methylpentanoyl]amino]phenyl]sulfanylpentanoic acid |
|---|---|
| PubChem CID | 40803024 |
| Molecular Formula | C17H25NO3S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (2S)-2-[2-[[(2R)-2-methylpentanoyl]amino]phenyl]sulfanylpentanoic acid |
| SMILES | CCCC(Sc1ccccc1NC(=O)[C@H](C)CCC)C(=O)O |
| InChI | InChI=1S/C17H25NO3S/c1-4-8-12(3)16(19)18-13-10-6-7-11-14(13)22-15(9-5-2)17(20)21/h6-7,10-12,15H,4-5,8-9H2,1-3H3,(H,18,19)(H,20,21)/t12-,15?/m1/s1 |
| InChIKey | SJRJJGPRDPECAE-KEKZHRQWSA-N |
| XLogP | 4.41 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |