C36H56N2O2S2 — CID 57116569
2-methyl-N-[2-[[2-(2-methylundecanoylamino)phenyl]disulfanyl]phenyl]undecanamide (PubChem CID 57116569) has the molecular formula C36H56N2O2S2 and a molecular weight of 612.99 g/mol. Its IUPAC name is 2-methyl-N-[2-[[2-(2-methylundecanoylamino)phenyl]disulfanyl]phenyl]undecanamide.
| Compound Name | 2-methyl-N-[2-[[2-(2-methylundecanoylamino)phenyl]disulfanyl]phenyl]undecanamide |
|---|---|
| PubChem CID | 57116569 |
| Molecular Formula | C36H56N2O2S2 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 612.38 |
| IUPAC Name | 2-methyl-N-[2-[[2-(2-methylundecanoylamino)phenyl]disulfanyl]phenyl]undecanamide |
| SMILES | CCCCCCCCCC(C)C(=O)Nc1ccccc1SSc1ccccc1NC(=O)C(C)CCCCCCCCC |
| InChI | InChI=1S/C36H56N2O2S2/c1-5-7-9-11-13-15-17-23-29(3)35(39)37-31-25-19-21-27-33(31)41-42-34-28-22-20-26-32(34)38-36(40)30(4)24-18-16-14-12-10-8-6-2/h19-22,25-30H,5-18,23-24H2,1-4H3,(H,37,39)(H,38,40) |
| InChIKey | XYCVHEMFIVCYEK-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|