C13H18F2N2OS — CID 47032909
1-[2-(Difluoromethylsulfanyl)phenyl]-3-pentan-2-ylurea (PubChem CID 47032909) has the molecular formula C13H18F2N2OS and a molecular weight of 288.36 g/mol. Its IUPAC name is 1-[2-(difluoromethylsulfanyl)phenyl]-3-pentan-2-ylurea.
| Compound Name | 1-[2-(Difluoromethylsulfanyl)phenyl]-3-pentan-2-ylurea |
|---|---|
| PubChem CID | 47032909 |
| Molecular Formula | C13H18F2N2OS |
| Molecular Weight | 288.36 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 1-[2-(difluoromethylsulfanyl)phenyl]-3-pentan-2-ylurea |
| SMILES | CCCC(C)NC(=O)NC1=CC=CC=C1SC(F)F |
| InChI | InChI=1S/C13H18F2N2OS/c1-3-6-9(2)16-13(18)17-10-7-4-5-8-11(10)19-12(14)15/h4-5,7-9,12H,3,6H2,1-2H3,(H2,16,17,18) |
| InChIKey | KUTYMHGMBXFBAI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 279 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |