C11H14F2N2O2S — CID 94818398
1-[2-(difluoromethylsulfanyl)phenyl]-3-[(2S)-1-hydroxypropan-2-yl]urea (PubChem CID 94818398) has the molecular formula C11H14F2N2O2S and a molecular weight of 276.31 g/mol. Its IUPAC name is 1-[2-(difluoromethylsulfanyl)phenyl]-3-[(2S)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-[2-(difluoromethylsulfanyl)phenyl]-3-[(2S)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 94818398 |
| Molecular Formula | C11H14F2N2O2S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 1-[2-(difluoromethylsulfanyl)phenyl]-3-[(2S)-1-hydroxypropan-2-yl]urea |
| SMILES | C[C@@H](CO)NC(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C11H14F2N2O2S/c1-7(6-16)14-11(17)15-8-4-2-3-5-9(8)18-10(12)13/h2-5,7,10,16H,6H2,1H3,(H2,14,15,17)/t7-/m0/s1 |
| InChIKey | JWTPQZFJRMWWLJ-ZETCQYMHSA-N |
| XLogP | 2.50 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |