C10H11F2NOS2 — CID 107020226
N-[2-(difluoromethylsulfanyl)phenyl]-2-sulfanylpropanamide (PubChem CID 107020226) has the molecular formula C10H11F2NOS2 and a molecular weight of 263.33 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-2-sulfanylpropanamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 107020226 |
| Molecular Formula | C10H11F2NOS2 |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-2-sulfanylpropanamide |
| SMILES | CC(S)C(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C10H11F2NOS2/c1-6(15)9(14)13-7-4-2-3-5-8(7)16-10(11)12/h2-6,10,15H,1H3,(H,13,14) |
| InChIKey | PQFQNTPHYMYCSL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|