C12H16F2N2O3S2 — CID 43105636
2-amino-N-[2-(difluoromethylsulfanyl)phenyl]-4-methylsulfonylbutanamide (PubChem CID 43105636) has the molecular formula C12H16F2N2O3S2 and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-amino-N-[2-(difluoromethylsulfanyl)phenyl]-4-methylsulfonylbutanamide.
| Compound Name | 2-amino-N-[2-(difluoromethylsulfanyl)phenyl]-4-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 43105636 |
| Molecular Formula | C12H16F2N2O3S2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-amino-N-[2-(difluoromethylsulfanyl)phenyl]-4-methylsulfonylbutanamide |
| SMILES | CS(=O)(=O)CCC(N)C(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C12H16F2N2O3S2/c1-21(18,19)7-6-8(15)11(17)16-9-4-2-3-5-10(9)20-12(13)14/h2-5,8,12H,6-7,15H2,1H3,(H,16,17) |
| InChIKey | BEGMMPYYYLYHJT-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |