C11H11F2NOS — CID 78906718
N-[2-(difluoromethylsulfanyl)phenyl]but-2-enamide (PubChem CID 78906718) has the molecular formula C11H11F2NOS and a molecular weight of 243.28 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]but-2-enamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]but-2-enamide |
|---|---|
| PubChem CID | 78906718 |
| Molecular Formula | C11H11F2NOS |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]but-2-enamide |
| SMILES | CC=CC(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C11H11F2NOS/c1-2-5-10(15)14-8-6-3-4-7-9(8)16-11(12)13/h2-7,11H,1H3,(H,14,15) |
| InChIKey | QMADFWBARXDCHM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|