C11H8F2NO3S- — CID 2330075
(E)-4-[2-(difluoromethylsulfanyl)anilino]-4-oxobut-2-enoate (PubChem CID 2330075) has the molecular formula C11H8F2NO3S- and a molecular weight of 272.25 g/mol. Its IUPAC name is (E)-4-[2-(difluoromethylsulfanyl)anilino]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[2-(difluoromethylsulfanyl)anilino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2330075 |
| Molecular Formula | C11H8F2NO3S- |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | (E)-4-[2-(difluoromethylsulfanyl)anilino]-4-oxobut-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C11H9F2NO3S/c12-11(13)18-8-4-2-1-3-7(8)14-9(15)5-6-10(16)17/h1-6,11H,(H,14,15)(H,16,17)/p-1/b6-5+ |
| InChIKey | ZQVPZEMNCOQEAU-AATRIKPKSA-M |
| XLogP | 1.25 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|