C11H7F3NO3S- — CID 6079917
(E)-4-oxo-4-[2-(trifluoromethylsulfanyl)anilino]but-2-enoate (PubChem CID 6079917) has the molecular formula C11H7F3NO3S- and a molecular weight of 290.24 g/mol. Its IUPAC name is (E)-4-oxo-4-[2-(trifluoromethylsulfanyl)anilino]but-2-enoate.
| Compound Name | (E)-4-oxo-4-[2-(trifluoromethylsulfanyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 6079917 |
| Molecular Formula | C11H7F3NO3S- |
| Molecular Weight | 290.24 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (E)-4-oxo-4-[2-(trifluoromethylsulfanyl)anilino]but-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C11H8F3NO3S/c12-11(13,14)19-8-4-2-1-3-7(8)15-9(16)5-6-10(17)18/h1-6H,(H,15,16)(H,17,18)/p-1/b6-5+ |
| InChIKey | PIDUNTNZZJUVNJ-AATRIKPKSA-M |
| XLogP | 1.54 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|