C13H15F3N2OS — CID 60866344
1-amino-N-[2-(trifluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide (PubChem CID 60866344) has the molecular formula C13H15F3N2OS and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-amino-N-[2-(trifluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide.
| Compound Name | 1-amino-N-[2-(trifluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 60866344 |
| Molecular Formula | C13H15F3N2OS |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-amino-N-[2-(trifluoromethylsulfanyl)phenyl]cyclopentane-1-carboxamide |
| SMILES | NC1(C(=O)Nc2ccccc2SC(F)(F)F)CCCC1 |
| InChI | InChI=1S/C13H15F3N2OS/c14-13(15,16)20-10-6-2-1-5-9(10)18-11(19)12(17)7-3-4-8-12/h1-2,5-6H,3-4,7-8,17H2,(H,18,19) |
| InChIKey | KGQQIKWBFNCJNK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |