C13H15F3N2O2S — CID 111573146
1-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea (PubChem CID 111573146) has the molecular formula C13H15F3N2O2S and a molecular weight of 320.34 g/mol. Its IUPAC name is 1-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea.
| Compound Name | 1-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea |
|---|---|
| PubChem CID | 111573146 |
| Molecular Formula | C13H15F3N2O2S |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | 1-[[1-(hydroxymethyl)cyclopropyl]methyl]-3-[2-(trifluoromethylsulfanyl)phenyl]urea |
| SMILES | O=C(NCC1(CO)CC1)Nc1ccccc1SC(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O2S/c14-13(15,16)21-10-4-2-1-3-9(10)18-11(20)17-7-12(8-19)5-6-12/h1-4,19H,5-8H2,(H2,17,18,20) |
| InChIKey | BXXKKOOCOZNMCG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |