C14H9F4NOS — CID 26180912
N-[2-(difluoromethylsulfanyl)phenyl]-3,5-difluorobenzamide (PubChem CID 26180912) has the molecular formula C14H9F4NOS and a molecular weight of 315.29 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfanyl)phenyl]-3,5-difluorobenzamide.
| Compound Name | N-[2-(difluoromethylsulfanyl)phenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 26180912 |
| Molecular Formula | C14H9F4NOS |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | N-[2-(difluoromethylsulfanyl)phenyl]-3,5-difluorobenzamide |
| SMILES | O=C(Nc1ccccc1SC(F)F)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H9F4NOS/c15-9-5-8(6-10(16)7-9)13(20)19-11-3-1-2-4-12(11)21-14(17)18/h1-7,14H,(H,19,20) |
| InChIKey | ZKJGFUDKOGOGAW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |