C13H9F2NO2 — CID 17396762
3,5-difluoro-N-(2-hydroxyphenyl)benzamide (PubChem CID 17396762) has the molecular formula C13H9F2NO2 and a molecular weight of 249.22 g/mol. Its IUPAC name is 3,5-difluoro-N-(2-hydroxyphenyl)benzamide.
| Compound Name | 3,5-difluoro-N-(2-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 17396762 |
| Molecular Formula | C13H9F2NO2 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3,5-difluoro-N-(2-hydroxyphenyl)benzamide |
| SMILES | O=C(Nc1ccccc1O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C13H9F2NO2/c14-9-5-8(6-10(15)7-9)13(18)16-11-3-1-2-4-12(11)17/h1-7,17H,(H,16,18) |
| InChIKey | VDWVXBXTZRDQOJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|