C12H16F2N2OS — CID 65225730
2-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]butanamide (PubChem CID 65225730) has the molecular formula C12H16F2N2OS and a molecular weight of 274.34 g/mol. Its IUPAC name is 2-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]butanamide.
| Compound Name | 2-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]butanamide |
|---|---|
| PubChem CID | 65225730 |
| Molecular Formula | C12H16F2N2OS |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(aminomethyl)-N-[2-(difluoromethylsulfanyl)phenyl]butanamide |
| SMILES | CCC(CN)C(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C12H16F2N2OS/c1-2-8(7-15)11(17)16-9-5-3-4-6-10(9)18-12(13)14/h3-6,8,12H,2,7,15H2,1H3,(H,16,17) |
| InChIKey | HZMVLMZTLVNBJE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |