C12H16F2N2O2S — CID 110890916
1-[2-(difluoromethylsulfanyl)phenyl]-3-(1-hydroxybutan-2-yl)urea (PubChem CID 110890916) has the molecular formula C12H16F2N2O2S and a molecular weight of 290.33 g/mol. Its IUPAC name is 1-[2-(difluoromethylsulfanyl)phenyl]-3-(1-hydroxybutan-2-yl)urea.
| Compound Name | 1-[2-(difluoromethylsulfanyl)phenyl]-3-(1-hydroxybutan-2-yl)urea |
|---|---|
| PubChem CID | 110890916 |
| Molecular Formula | C12H16F2N2O2S |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 1-[2-(difluoromethylsulfanyl)phenyl]-3-(1-hydroxybutan-2-yl)urea |
| SMILES | CCC(CO)NC(=O)Nc1ccccc1SC(F)F |
| InChI | InChI=1S/C12H16F2N2O2S/c1-2-8(7-17)15-12(18)16-9-5-3-4-6-10(9)19-11(13)14/h3-6,8,11,17H,2,7H2,1H3,(H2,15,16,18) |
| InChIKey | GOJHVSYAOFTCNW-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |