C10H13FN2O3 — CID 5130491
1-(1,3-dihydroxypropan-2-yl)-3-(2-fluorophenyl)urea (PubChem CID 5130491) has the molecular formula C10H13FN2O3 and a molecular weight of 228.22 g/mol. Its IUPAC name is 1-(1,3-dihydroxypropan-2-yl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(1,3-dihydroxypropan-2-yl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 5130491 |
| Molecular Formula | C10H13FN2O3 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 1-(1,3-dihydroxypropan-2-yl)-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccccc1F)NC(CO)CO |
| InChI | InChI=1S/C10H13FN2O3/c11-8-3-1-2-4-9(8)13-10(16)12-7(5-14)6-15/h1-4,7,14-15H,5-6H2,(H2,12,13,16) |
| InChIKey | FSSGPPJQAPJKPG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |