C12H16FNO6 — CID 72548624
(2R,3S,4R,5R)-N-(2-fluorophenyl)-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 72548624) has the molecular formula C12H16FNO6 and a molecular weight of 289.26 g/mol. Its IUPAC name is (2R,3S,4R,5R)-N-(2-fluorophenyl)-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2R,3S,4R,5R)-N-(2-fluorophenyl)-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 72548624 |
| Molecular Formula | C12H16FNO6 |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | (2R,3S,4R,5R)-N-(2-fluorophenyl)-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | O=C(Nc1ccccc1F)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H16FNO6/c13-6-3-1-2-4-7(6)14-12(20)11(19)10(18)9(17)8(16)5-15/h1-4,8-11,15-19H,5H2,(H,14,20)/t8-,9-,10+,11-/m1/s1 |
| InChIKey | AXQTXPZVJSFTSL-CHWFTXMASA-N |
| XLogP | -1.80 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |