C13H20N2O7 — CID 102513203
(2R,3R,4S,5R,6R)-N-(2-aminophenyl)-2,3,4,5,6,7-hexahydroxyheptanamide (PubChem CID 102513203) has the molecular formula C13H20N2O7 and a molecular weight of 316.31 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-N-(2-aminophenyl)-2,3,4,5,6,7-hexahydroxyheptanamide.
| Compound Name | (2R,3R,4S,5R,6R)-N-(2-aminophenyl)-2,3,4,5,6,7-hexahydroxyheptanamide |
|---|---|
| PubChem CID | 102513203 |
| Molecular Formula | C13H20N2O7 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (2R,3R,4S,5R,6R)-N-(2-aminophenyl)-2,3,4,5,6,7-hexahydroxyheptanamide |
| SMILES | Nc1ccccc1NC(=O)[C@H](O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H20N2O7/c14-6-3-1-2-4-7(6)15-13(22)12(21)11(20)10(19)9(18)8(17)5-16/h1-4,8-12,16-21H,5,14H2,(H,15,22)/t8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | JQTOPRCLVJFSLQ-RMPHRYRLSA-N |
| XLogP | -3.00 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|