C11H18N2O4 — CID 25169850
(2R,3S,4S)-5-(2-aminoanilino)pentane-1,2,3,4-tetrol (PubChem CID 25169850) has the molecular formula C11H18N2O4 and a molecular weight of 242.28 g/mol. Its IUPAC name is (2R,3S,4S)-5-(2-aminoanilino)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4S)-5-(2-aminoanilino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 25169850 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2R,3S,4S)-5-(2-aminoanilino)pentane-1,2,3,4-tetrol |
| SMILES | Nc1ccccc1NC[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H18N2O4/c12-7-3-1-2-4-8(7)13-5-9(15)11(17)10(16)6-14/h1-4,9-11,13-17H,5-6,12H2/t9-,10+,11-/m0/s1 |
| InChIKey | FTHQNFWWNKXWAH-AXFHLTTASA-N |
| XLogP | -1.24 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|