C13H21NO4 — CID 70539153
(2R,3R,4R)-5-(2,4-dimethylanilino)pentane-1,2,3,4-tetrol (PubChem CID 70539153) has the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. Its IUPAC name is (2R,3R,4R)-5-(2,4-dimethylanilino)pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4R)-5-(2,4-dimethylanilino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 70539153 |
| Molecular Formula | C13H21NO4 |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | (2R,3R,4R)-5-(2,4-dimethylanilino)pentane-1,2,3,4-tetrol |
| SMILES | Cc1ccc(NC[C@@H](O)[C@@H](O)[C@H](O)CO)c(C)c1 |
| InChI | InChI=1S/C13H21NO4/c1-8-3-4-10(9(2)5-8)14-6-11(16)13(18)12(17)7-15/h3-5,11-18H,6-7H2,1-2H3/t11-,12-,13-/m1/s1 |
| InChIKey | UIRHZMSUTRWAIS-JHJVBQTASA-N |
| XLogP | -0.21 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |