C11H15NO5 — CID 54295332
(2R,3R,4R)-2,3,4,5-tetrahydroxy-N-phenylpentanamide (PubChem CID 54295332) has the molecular formula C11H15NO5 and a molecular weight of 241.24 g/mol. Its IUPAC name is (2R,3R,4R)-2,3,4,5-tetrahydroxy-N-phenylpentanamide.
| Compound Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-N-phenylpentanamide |
|---|---|
| PubChem CID | 54295332 |
| Molecular Formula | C11H15NO5 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | (2R,3R,4R)-2,3,4,5-tetrahydroxy-N-phenylpentanamide |
| SMILES | O=C(Nc1ccccc1)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H15NO5/c13-6-8(14)9(15)10(16)11(17)12-7-4-2-1-3-5-7/h1-5,8-10,13-16H,6H2,(H,12,17)/t8-,9-,10-/m1/s1 |
| InChIKey | SAJYVZIPVNGGCE-OPRDCNLKSA-N |
| XLogP | -1.30 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |