C13H18N2O7 — CID 98572843
(2R,4S,5R,6R)-2,4,5,6,7-pentahydroxy-3-oxo-N'-phenylheptanehydrazide (PubChem CID 98572843) has the molecular formula C13H18N2O7 and a molecular weight of 314.29 g/mol. Its IUPAC name is (2R,4S,5R,6R)-2,4,5,6,7-pentahydroxy-3-oxo-N'-phenylheptanehydrazide.
| Compound Name | (2R,4S,5R,6R)-2,4,5,6,7-pentahydroxy-3-oxo-N'-phenylheptanehydrazide |
|---|---|
| PubChem CID | 98572843 |
| Molecular Formula | C13H18N2O7 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (2R,4S,5R,6R)-2,4,5,6,7-pentahydroxy-3-oxo-N'-phenylheptanehydrazide |
| SMILES | O=C(NNc1ccccc1)[C@H](O)C(=O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H18N2O7/c16-6-8(17)9(18)10(19)11(20)12(21)13(22)15-14-7-4-2-1-3-5-7/h1-5,8-10,12,14,16-19,21H,6H2,(H,15,22)/t8-,9-,10+,12-/m1/s1 |
| InChIKey | NNEITPLYIQNYFI-MWGHHZFTSA-N |
| XLogP | -2.87 |
| TPSA | 159.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|