C18H22N4O3 — CID 1239861
2-[(2R)-2-hydroxypropyl]-1-N',3-N'-diphenylpropanedihydrazide (PubChem CID 1239861) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-[(2R)-2-hydroxypropyl]-1-N',3-N'-diphenylpropanedihydrazide.
| Compound Name | 2-[(2R)-2-hydroxypropyl]-1-N',3-N'-diphenylpropanedihydrazide |
|---|---|
| PubChem CID | 1239861 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 2-[(2R)-2-hydroxypropyl]-1-N',3-N'-diphenylpropanedihydrazide |
| SMILES | C[C@@H](O)CC(C(=O)NNc1ccccc1)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C18H22N4O3/c1-13(23)12-16(17(24)21-19-14-8-4-2-5-9-14)18(25)22-20-15-10-6-3-7-11-15/h2-11,13,16,19-20,23H,12H2,1H3,(H,21,24)(H,22,25)/t13-/m1/s1 |
| InChIKey | JCMQWOCLPITYHB-CYBMUJFWSA-N |
| XLogP | 1.66 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|