C12H18N2O5 — CID 131873051
(2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-N'-phenylhexanehydrazide (PubChem CID 131873051) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-N'-phenylhexanehydrazide.
| Compound Name | (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-N'-phenylhexanehydrazide |
|---|---|
| PubChem CID | 131873051 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2R,3S,4S,5R)-2,3,4,5-tetrahydroxy-N'-phenylhexanehydrazide |
| SMILES | C[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C12H18N2O5/c1-7(15)9(16)10(17)11(18)12(19)14-13-8-5-3-2-4-6-8/h2-7,9-11,13,15-18H,1H3,(H,14,19)/t7-,9+,10+,11-/m1/s1 |
| InChIKey | WQDQMZRHLJQUIR-GRLWKWRFSA-N |
| XLogP | -1.41 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|