C12H18N2O6 — CID 131874259
(2S,3R,4R)-2,3,4,5-tetrahydroxy-N'-(3-methoxyphenyl)pentanehydrazide (PubChem CID 131874259) has the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. Its IUPAC name is (2S,3R,4R)-2,3,4,5-tetrahydroxy-N'-(3-methoxyphenyl)pentanehydrazide.
| Compound Name | (2S,3R,4R)-2,3,4,5-tetrahydroxy-N'-(3-methoxyphenyl)pentanehydrazide |
|---|---|
| PubChem CID | 131874259 |
| Molecular Formula | C12H18N2O6 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | (2S,3R,4R)-2,3,4,5-tetrahydroxy-N'-(3-methoxyphenyl)pentanehydrazide |
| SMILES | COc1cccc(NNC(=O)[C@@H](O)[C@H](O)[C@H](O)CO)c1 |
| InChI | InChI=1S/C12H18N2O6/c1-20-8-4-2-3-7(5-8)13-14-12(19)11(18)10(17)9(16)6-15/h2-5,9-11,13,15-18H,6H2,1H3,(H,14,19)/t9-,10-,11+/m1/s1 |
| InChIKey | PUJRBOFTARENLB-MXWKQRLJSA-N |
| XLogP | -1.79 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|