C18H20N2O4 — CID 23745027
[1-(3-methoxyanilino)-1-oxobutan-2-yl] 3-aminobenzoate (PubChem CID 23745027) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is [1-(3-methoxyanilino)-1-oxobutan-2-yl] 3-aminobenzoate.
| Compound Name | [1-(3-methoxyanilino)-1-oxobutan-2-yl] 3-aminobenzoate |
|---|---|
| PubChem CID | 23745027 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | [1-(3-methoxyanilino)-1-oxobutan-2-yl] 3-aminobenzoate |
| SMILES | CCC(OC(=O)c1cccc(N)c1)C(=O)Nc1cccc(OC)c1 |
| InChI | InChI=1S/C18H20N2O4/c1-3-16(24-18(22)12-6-4-7-13(19)10-12)17(21)20-14-8-5-9-15(11-14)23-2/h4-11,16H,3,19H2,1-2H3,(H,20,21) |
| InChIKey | PQTZTZMEIUOHDP-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|