C17H16FNO4 — CID 8612332
[(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 3-fluorobenzoate (PubChem CID 8612332) has the molecular formula C17H16FNO4 and a molecular weight of 317.32 g/mol. Its IUPAC name is [(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 3-fluorobenzoate.
| Compound Name | [(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 3-fluorobenzoate |
|---|---|
| PubChem CID | 8612332 |
| Molecular Formula | C17H16FNO4 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | [(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 3-fluorobenzoate |
| SMILES | COc1cccc(NC(=O)[C@H](C)OC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C17H16FNO4/c1-11(23-17(21)12-5-3-6-13(18)9-12)16(20)19-14-7-4-8-15(10-14)22-2/h3-11H,1-2H3,(H,19,20)/t11-/m0/s1 |
| InChIKey | OTSGGKGRUFEYBM-NSHDSACASA-N |
| XLogP | 3.02 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |