C18H19NO4S — CID 8507735
[(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate (PubChem CID 8507735) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate.
| Compound Name | [(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
|---|---|
| PubChem CID | 8507735 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [(2S)-1-(3-methoxyanilino)-1-oxopropan-2-yl] 4-methylsulfanylbenzoate |
| SMILES | COc1cccc(NC(=O)[C@H](C)OC(=O)c2ccc(SC)cc2)c1 |
| InChI | InChI=1S/C18H19NO4S/c1-12(17(20)19-14-5-4-6-15(11-14)22-2)23-18(21)13-7-9-16(24-3)10-8-13/h4-12H,1-3H3,(H,19,20)/t12-/m0/s1 |
| InChIKey | LCULLFQGGKNTKQ-LBPRGKRZSA-N |
| XLogP | 3.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |