C22H22N2O4 — CID 6724234
(2S)-3-hydroxy-N-(3-methoxyphenyl)-2-[(2-naphthalen-1-ylacetyl)amino]propanamide (PubChem CID 6724234) has the molecular formula C22H22N2O4 and a molecular weight of 378.43 g/mol. Its IUPAC name is (2S)-3-hydroxy-N-(3-methoxyphenyl)-2-[(2-naphthalen-1-ylacetyl)amino]propanamide.
| Compound Name | (2S)-3-hydroxy-N-(3-methoxyphenyl)-2-[(2-naphthalen-1-ylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 6724234 |
| Molecular Formula | C22H22N2O4 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | (2S)-3-hydroxy-N-(3-methoxyphenyl)-2-[(2-naphthalen-1-ylacetyl)amino]propanamide |
| SMILES | COc1cccc(NC(=O)[C@H](CO)NC(=O)Cc2cccc3ccccc23)c1 |
| InChI | InChI=1S/C22H22N2O4/c1-28-18-10-5-9-17(13-18)23-22(27)20(14-25)24-21(26)12-16-8-4-7-15-6-2-3-11-19(15)16/h2-11,13,20,25H,12,14H2,1H3,(H,23,27)(H,24,26)/t20-/m0/s1 |
| InChIKey | DRZCQAQBMDSCKA-FQEVSTJZSA-N |
| XLogP | 2.51 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |