C15H22N2O5 — CID 22501705
tert-butyl N-[3-hydroxy-1-(3-methoxyanilino)-1-oxopropan-2-yl]carbamate (PubChem CID 22501705) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-1-(3-methoxyanilino)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-1-(3-methoxyanilino)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 22501705 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl N-[3-hydroxy-1-(3-methoxyanilino)-1-oxopropan-2-yl]carbamate |
| SMILES | COc1cccc(NC(=O)C(CO)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H22N2O5/c1-15(2,3)22-14(20)17-12(9-18)13(19)16-10-6-5-7-11(8-10)21-4/h5-8,12,18H,9H2,1-4H3,(H,16,19)(H,17,20) |
| InChIKey | MPRWBZLFGJJSLR-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |