C15H17N3O — CID 11379833
(2S)-2-amino-N',3-diphenylpropanehydrazide (PubChem CID 11379833) has the molecular formula C15H17N3O and a molecular weight of 255.32 g/mol. Its IUPAC name is (2S)-2-amino-N',3-diphenylpropanehydrazide.
| Compound Name | (2S)-2-amino-N',3-diphenylpropanehydrazide |
|---|---|
| PubChem CID | 11379833 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | (2S)-2-amino-N',3-diphenylpropanehydrazide |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C15H17N3O/c16-14(11-12-7-3-1-4-8-12)15(19)18-17-13-9-5-2-6-10-13/h1-10,14,17H,11,16H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | RJFZUBFEKYNIDB-AWEZNQCLSA-N |
| XLogP | 1.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|