C11H17N2O3P — CID 22811613
1-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethylphosphonous acid (PubChem CID 22811613) has the molecular formula C11H17N2O3P and a molecular weight of 256.24 g/mol. Its IUPAC name is 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethylphosphonous acid.
| Compound Name | 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethylphosphonous acid |
|---|---|
| PubChem CID | 22811613 |
| Molecular Formula | C11H17N2O3P |
| Molecular Weight | 256.24 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-[[(2S)-2-amino-3-phenylpropanoyl]amino]ethylphosphonous acid |
| SMILES | CC(NC(=O)[C@@H](N)Cc1ccccc1)P(O)O |
| InChI | InChI=1S/C11H17N2O3P/c1-8(17(15)16)13-11(14)10(12)7-9-5-3-2-4-6-9/h2-6,8,10,15-16H,7,12H2,1H3,(H,13,14)/t8?,10-/m0/s1 |
| InChIKey | LPJKHXAZUCNDDV-HTLJXXAVSA-N |
| XLogP | 0.32 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.24 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|