C18H20N4O2 — CID 5088249
1-N',3-N'-diphenyl-2-prop-2-enylpropanedihydrazide (PubChem CID 5088249) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-N',3-N'-diphenyl-2-prop-2-enylpropanedihydrazide.
| Compound Name | 1-N',3-N'-diphenyl-2-prop-2-enylpropanedihydrazide |
|---|---|
| PubChem CID | 5088249 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 1-N',3-N'-diphenyl-2-prop-2-enylpropanedihydrazide |
| SMILES | C=CCC(C(=O)NNc1ccccc1)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C18H20N4O2/c1-2-9-16(17(23)21-19-14-10-5-3-6-11-14)18(24)22-20-15-12-7-4-8-13-15/h2-8,10-13,16,19-20H,1,9H2,(H,21,23)(H,22,24) |
| InChIKey | HYYHDCDVFFRXMM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|