C13H18N4OS2 — CID 135391424
(2S)-2-(5-methyl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)-N'-phenylpropanehydrazide (PubChem CID 135391424) has the molecular formula C13H18N4OS2 and a molecular weight of 310.45 g/mol. Its IUPAC name is (2S)-2-(5-methyl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)-N'-phenylpropanehydrazide.
| Compound Name | (2S)-2-(5-methyl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)-N'-phenylpropanehydrazide |
|---|---|
| PubChem CID | 135391424 |
| Molecular Formula | C13H18N4OS2 |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2S)-2-(5-methyl-6-sulfanylidene-1,3,5-thiadiazinan-3-yl)-N'-phenylpropanehydrazide |
| SMILES | C[C@@H](C(=O)NNc1ccccc1)N1CSC(=S)N(C)C1 |
| InChI | InChI=1S/C13H18N4OS2/c1-10(17-8-16(2)13(19)20-9-17)12(18)15-14-11-6-4-3-5-7-11/h3-7,10,14H,8-9H2,1-2H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | GYHRSJKFKGWFHF-JTQLQIEISA-N |
| XLogP | 1.70 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|