About 1-anilino-3-ethylurea
1-anilino-3-ethylurea (PubChem CID 67472651) has the molecular formula C9H13N3O
and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-anilino-3-ethylurea.
Molecular Properties
| Compound Name | 1-anilino-3-ethylurea |
| PubChem CID | 67472651 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 1-anilino-3-ethylurea |
| SMILES | CCNC(=O)NNc1ccccc1 |
| InChI | InChI=1S/C9H13N3O/c1-2-10-9(13)12-11-8-6-4-3-5-7-8/h3-7,11H,2H2,1H3,(H2,10,12,13) |
| InChIKey | LWTAMHNNFFPYKX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-anilino-3-ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-anilino-3-ethylurea?
The IUPAC name of 1-anilino-3-ethylurea (CID 67472651) is 1-anilino-3-ethylurea.
What is the SMILES notation for 1-anilino-3-ethylurea?
The canonical SMILES for 1-anilino-3-ethylurea is CCNC(=O)NNc1ccccc1.
What is the InChIKey of 1-anilino-3-ethylurea?
The InChIKey is LWTAMHNNFFPYKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O/c1-2-10-9(13)12-11-8-6-4-3-5-7-8/h3-7,11H,2H2,1H3,(H2,10,12,13).
What are the key properties of 1-anilino-3-ethylurea?
1-anilino-3-ethylurea has a molecular weight of 179.22 g/mol, XLogP of 1.33, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-anilino-3-ethylurea is sourced from PubChem (CID 67472651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).