C17H25N3O3 — CID 11278618
4-[(2S)-4-methyl-1-oxo-1-(2-phenylhydrazinyl)pentan-2-yl]iminopentanoic acid (PubChem CID 11278618) has the molecular formula C17H25N3O3 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4-[(2S)-4-methyl-1-oxo-1-(2-phenylhydrazinyl)pentan-2-yl]iminopentanoic acid.
| Compound Name | 4-[(2S)-4-methyl-1-oxo-1-(2-phenylhydrazinyl)pentan-2-yl]iminopentanoic acid |
|---|---|
| PubChem CID | 11278618 |
| Molecular Formula | C17H25N3O3 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 4-[(2S)-4-methyl-1-oxo-1-(2-phenylhydrazinyl)pentan-2-yl]iminopentanoic acid |
| SMILES | C/C(CCC(=O)O)=N\[C@@H](CC(C)C)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C17H25N3O3/c1-12(2)11-15(18-13(3)9-10-16(21)22)17(23)20-19-14-7-5-4-6-8-14/h4-8,12,15,19H,9-11H2,1-3H3,(H,20,23)(H,21,22)/b18-13+/t15-/m0/s1 |
| InChIKey | CZNOILCXDSZYAU-VUODPORTSA-N |
| XLogP | 2.87 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|