C16H23N3O3S — CID 11198515
4-[(2S)-4-methylsulfanyl-1-oxo-1-(2-phenylhydrazinyl)butan-2-yl]iminopentanoic acid (PubChem CID 11198515) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is 4-[(2S)-4-methylsulfanyl-1-oxo-1-(2-phenylhydrazinyl)butan-2-yl]iminopentanoic acid.
| Compound Name | 4-[(2S)-4-methylsulfanyl-1-oxo-1-(2-phenylhydrazinyl)butan-2-yl]iminopentanoic acid |
|---|---|
| PubChem CID | 11198515 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 4-[(2S)-4-methylsulfanyl-1-oxo-1-(2-phenylhydrazinyl)butan-2-yl]iminopentanoic acid |
| SMILES | CSCC[C@H](/N=C(\C)CCC(=O)O)C(=O)NNc1ccccc1 |
| InChI | InChI=1S/C16H23N3O3S/c1-12(8-9-15(20)21)17-14(10-11-23-2)16(22)19-18-13-6-4-3-5-7-13/h3-7,14,18H,8-11H2,1-2H3,(H,19,22)(H,20,21)/b17-12+/t14-/m0/s1 |
| InChIKey | YKUJNYYMMIKHKP-IQGJIOQQSA-N |
| XLogP | 2.58 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|