C12H17N3O4 — CID 88918747
(5Z)-6-imino-5-(phenylhydrazinylidene)hexane-1,2,3,4-tetrol (PubChem CID 88918747) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is (5Z)-6-imino-5-(phenylhydrazinylidene)hexane-1,2,3,4-tetrol.
| Compound Name | (5Z)-6-imino-5-(phenylhydrazinylidene)hexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 88918747 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | (5Z)-6-imino-5-(phenylhydrazinylidene)hexane-1,2,3,4-tetrol |
| SMILES | [H]/N=C/C(=N/Nc1ccccc1)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C12H17N3O4/c13-6-9(11(18)12(19)10(17)7-16)15-14-8-4-2-1-3-5-8/h1-6,10-14,16-19H,7H2/b13-6+,15-9- |
| InChIKey | ZPGNFAJFRMPURM-OELJXHARSA-N |
| XLogP | -0.82 |
| TPSA | 129.16 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|