C16H18N4O2 — CID 72710757
(2S,4E)-3,4-bis(phenylhydrazinylidene)butane-1,2-diol (PubChem CID 72710757) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (2S,4E)-3,4-bis(phenylhydrazinylidene)butane-1,2-diol.
| Compound Name | (2S,4E)-3,4-bis(phenylhydrazinylidene)butane-1,2-diol |
|---|---|
| PubChem CID | 72710757 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (2S,4E)-3,4-bis(phenylhydrazinylidene)butane-1,2-diol |
| SMILES | OC[C@@H](O)C(/C=N/Nc1ccccc1)=NNc1ccccc1 |
| InChI | InChI=1S/C16H18N4O2/c21-12-16(22)15(20-19-14-9-5-2-6-10-14)11-17-18-13-7-3-1-4-8-13/h1-11,16,18-19,21-22H,12H2/b17-11+,20-15?/t16-/m1/s1 |
| InChIKey | VNANLDVSKUEPHC-FERJOWQHSA-N |
| XLogP | 1.91 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|