About (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide
(2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide (PubChem CID 15309595) has the molecular formula C14H15N5
and a molecular weight of 253.31 g/mol. Its IUPAC name is (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide.
Molecular Properties
| Compound Name | (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide |
| PubChem CID | 15309595 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide |
| SMILES | NC(/C=N/Nc1ccccc1)=N\Nc1ccccc1 |
| InChI | InChI=1S/C14H15N5/c15-14(19-18-13-9-5-2-6-10-13)11-16-17-12-7-3-1-4-8-12/h1-11,17-18H,(H2,15,19)/b16-11+ |
| InChIKey | RGTZXMAUWBFYCG-LFIBNONCSA-N |
| XLogP | 2.47 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide?
The IUPAC name of (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide (CID 15309595) is (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide.
What is the SMILES notation for (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide?
The canonical SMILES for (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide is NC(/C=N/Nc1ccccc1)=N\Nc1ccccc1.
What is the InChIKey of (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide?
The InChIKey is RGTZXMAUWBFYCG-LFIBNONCSA-N. The full InChI is InChI=1S/C14H15N5/c15-14(19-18-13-9-5-2-6-10-13)11-16-17-12-7-3-1-4-8-12/h1-11,17-18H,(H2,15,19)/b16-11+.
What are the key properties of (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide?
(2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide has a molecular weight of 253.31 g/mol, XLogP of 2.47, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N'-anilino-2-(phenylhydrazinylidene)ethanimidamide is sourced from PubChem (CID 15309595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).